C14H12O6 — CID 88783743
3-methylideneoxolane-2,5-dione;4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 88783743) has the molecular formula C14H12O6 and a molecular weight of 276.24 g/mol. Its IUPAC name is 3-methylideneoxolane-2,5-dione;4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 3-methylideneoxolane-2,5-dione;4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 88783743 |
| Molecular Formula | C14H12O6 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 3-methylideneoxolane-2,5-dione;4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | C=C1CC(=O)OC1=O.O=C1OC(=O)C2C3C=CC(C3)C12 |
| InChI | InChI=1S/C9H8O3.C5H4O3/c10-8-6-4-1-2-5(3-4)7(6)9(11)12-8;1-3-2-4(6)8-5(3)7/h1-2,4-7H,3H2;1-2H2 |
| InChIKey | FEKJZSWLHYSRGY-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|