About 7-hydroxy-3,3a,7,7a-tetrahydro-1-benzofuran-2,6-dione
7-hydroxy-3,3a,7,7a-tetrahydro-1-benzofuran-2,6-dione (PubChem CID 143612632) has the molecular formula C8H8O4
and a molecular weight of 168.15 g/mol. Its IUPAC name is 7-hydroxy-3,3a,7,7a-tetrahydro-1-benzofuran-2,6-dione.
Analyze 7-hydroxy-3,3a,7,7a-tetrahydro-1-benzofuran-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-3,3a,7,7a-tetrahydro-1-benzofuran-2,6-dione?
The IUPAC name of 7-hydroxy-3,3a,7,7a-tetrahydro-1-benzofuran-2,6-dione (CID 143612632) is 7-hydroxy-3,3a,7,7a-tetrahydro-1-benzofuran-2,6-dione.
What is the SMILES notation for 7-hydroxy-3,3a,7,7a-tetrahydro-1-benzofuran-2,6-dione?
The canonical SMILES for 7-hydroxy-3,3a,7,7a-tetrahydro-1-benzofuran-2,6-dione is O=C1CC2C=CC(=O)C(O)C2O1.
What is the InChIKey of 7-hydroxy-3,3a,7,7a-tetrahydro-1-benzofuran-2,6-dione?
The InChIKey is JSVLXRMPJZOVOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O4/c9-5-2-1-4-3-6(10)12-8(4)7(5)11/h1-2,4,7-8,11H,3H2.
What are the key properties of 7-hydroxy-3,3a,7,7a-tetrahydro-1-benzofuran-2,6-dione?
7-hydroxy-3,3a,7,7a-tetrahydro-1-benzofuran-2,6-dione has a molecular weight of 168.15 g/mol, XLogP of -0.58, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-3,3a,7,7a-tetrahydro-1-benzofuran-2,6-dione is sourced from PubChem (CID 143612632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).