C10H14O4 — CID 130149623
4,6-dihydroxy-5-propan-2-ylidene-3a,4,6,6a-tetrahydro-3H-cyclopenta[b]furan-2-one (PubChem CID 130149623) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is 4,6-dihydroxy-5-propan-2-ylidene-3a,4,6,6a-tetrahydro-3H-cyclopenta[b]furan-2-one.
| Compound Name | 4,6-dihydroxy-5-propan-2-ylidene-3a,4,6,6a-tetrahydro-3H-cyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 130149623 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 4,6-dihydroxy-5-propan-2-ylidene-3a,4,6,6a-tetrahydro-3H-cyclopenta[b]furan-2-one |
| SMILES | CC(C)=C1C(O)C2CC(=O)OC2C1O |
| InChI | InChI=1S/C10H14O4/c1-4(2)7-8(12)5-3-6(11)14-10(5)9(7)13/h5,8-10,12-13H,3H2,1-2H3 |
| InChIKey | IUTQUYHKVFWXOZ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|