C6H8O3S — CID 10702102
(3aS,6R,6aS)-6-hydroxy-3a,5,6,6a-tetrahydro-3H-thieno[3,2-b]furan-2-one (PubChem CID 10702102) has the molecular formula C6H8O3S and a molecular weight of 160.19 g/mol. Its IUPAC name is (3aS,6R,6aS)-6-hydroxy-3a,5,6,6a-tetrahydro-3H-thieno[3,2-b]furan-2-one.
| Compound Name | (3aS,6R,6aS)-6-hydroxy-3a,5,6,6a-tetrahydro-3H-thieno[3,2-b]furan-2-one |
|---|---|
| PubChem CID | 10702102 |
| Molecular Formula | C6H8O3S |
| Molecular Weight | 160.19 g/mol |
| Exact Mass | 160.02 |
| IUPAC Name | (3aS,6R,6aS)-6-hydroxy-3a,5,6,6a-tetrahydro-3H-thieno[3,2-b]furan-2-one |
| SMILES | O=C1C[C@@H]2SC[C@H](O)[C@@H]2O1 |
| InChI | InChI=1S/C6H8O3S/c7-3-2-10-4-1-5(8)9-6(3)4/h3-4,6-7H,1-2H2/t3-,4-,6-/m0/s1 |
| InChIKey | FNZBQNPNBNPDHK-FKZODXBYSA-N |
| XLogP | -0.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.19 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |