C18H26O5S — CID 10522100
(1S,2R,4S,6S,7E,12S,16S)-4-hydroxy-12-methyl-13,20-dioxa-17-thiatricyclo[14.4.0.02,6]icos-7-ene-14,19-dione (PubChem CID 10522100) has the molecular formula C18H26O5S and a molecular weight of 354.47 g/mol. Its IUPAC name is (1S,2R,4S,6S,7E,12S,16S)-4-hydroxy-12-methyl-13,20-dioxa-17-thiatricyclo[14.4.0.02,6]icos-7-ene-14,19-dione.
| Compound Name | (1S,2R,4S,6S,7E,12S,16S)-4-hydroxy-12-methyl-13,20-dioxa-17-thiatricyclo[14.4.0.02,6]icos-7-ene-14,19-dione |
|---|---|
| PubChem CID | 10522100 |
| Molecular Formula | C18H26O5S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (1S,2R,4S,6S,7E,12S,16S)-4-hydroxy-12-methyl-13,20-dioxa-17-thiatricyclo[14.4.0.02,6]icos-7-ene-14,19-dione |
| SMILES | C[C@H]1CCC/C=C/[C@@H]2C[C@H](O)C[C@H]2[C@@H]2OC(=O)CS[C@H]2CC(=O)O1 |
| InChI | InChI=1S/C18H26O5S/c1-11-5-3-2-4-6-12-7-13(19)8-14(12)18-15(9-16(20)22-11)24-10-17(21)23-18/h4,6,11-15,18-19H,2-3,5,7-10H2,1H3/b6-4+/t11-,12+,13-,14+,15-,18-/m0/s1 |
| InChIKey | RTPSXVWYBQWHPE-RHQYHPPLSA-N |
| XLogP | 2.46 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|