C18H28O6S — CID 100916376
2-[[(1R,2R,3R,7S,11E,13S,15S)-2,15-dihydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadec-11-en-3-yl]sulfanyl]acetic acid (PubChem CID 100916376) has the molecular formula C18H28O6S and a molecular weight of 372.48 g/mol. Its IUPAC name is 2-[[(1R,2R,3R,7S,11E,13S,15S)-2,15-dihydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadec-11-en-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[(1R,2R,3R,7S,11E,13S,15S)-2,15-dihydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadec-11-en-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 100916376 |
| Molecular Formula | C18H28O6S |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 2-[[(1R,2R,3R,7S,11E,13S,15S)-2,15-dihydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadec-11-en-3-yl]sulfanyl]acetic acid |
| SMILES | C[C@H]1CCC/C=C/[C@@H]2C[C@H](O)C[C@H]2[C@@H](O)[C@H](SCC(=O)O)CC(=O)O1 |
| InChI | InChI=1S/C18H28O6S/c1-11-5-3-2-4-6-12-7-13(19)8-14(12)18(23)15(9-17(22)24-11)25-10-16(20)21/h4,6,11-15,18-19,23H,2-3,5,7-10H2,1H3,(H,20,21)/b6-4+/t11-,12+,13-,14+,15+,18+/m0/s1 |
| InChIKey | RVCAYFHARUYNTM-FYCWSXJGSA-N |
| XLogP | 1.98 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|