C23H32O6S — CID 100916391
(1R,2R,3R,7S,11E,13S,15S)-2,15-dihydroxy-3-(2-methoxyphenyl)sulfinyl-7-methyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one (PubChem CID 100916391) has the molecular formula C23H32O6S and a molecular weight of 436.57 g/mol. Its IUPAC name is (1R,2R,3R,7S,11E,13S,15S)-2,15-dihydroxy-3-(2-methoxyphenyl)sulfinyl-7-methyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one.
| Compound Name | (1R,2R,3R,7S,11E,13S,15S)-2,15-dihydroxy-3-(2-methoxyphenyl)sulfinyl-7-methyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one |
|---|---|
| PubChem CID | 100916391 |
| Molecular Formula | C23H32O6S |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (1R,2R,3R,7S,11E,13S,15S)-2,15-dihydroxy-3-(2-methoxyphenyl)sulfinyl-7-methyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one |
| SMILES | COc1ccccc1S(=O)[C@@H]1CC(=O)O[C@@H](C)CCC/C=C/[C@@H]2C[C@H](O)C[C@H]2[C@H]1O |
| InChI | InChI=1S/C23H32O6S/c1-15-8-4-3-5-9-16-12-17(24)13-18(16)23(26)21(14-22(25)29-15)30(27)20-11-7-6-10-19(20)28-2/h5-7,9-11,15-18,21,23-24,26H,3-4,8,12-14H2,1-2H3/b9-5+/t15-,16+,17-,18+,21+,23+,30?/m0/s1 |
| InChIKey | BAAYXCAUDWLFFH-OVMFUBCNSA-N |
| XLogP | 2.98 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|