C20H34O5S — CID 10937921
(1R,2S,3R,7S,11E,13S,15S)-2,15-dihydroxy-3-(4-hydroxybutylsulfanyl)-7-methyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one (PubChem CID 10937921) has the molecular formula C20H34O5S and a molecular weight of 386.55 g/mol. Its IUPAC name is (1R,2S,3R,7S,11E,13S,15S)-2,15-dihydroxy-3-(4-hydroxybutylsulfanyl)-7-methyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one.
| Compound Name | (1R,2S,3R,7S,11E,13S,15S)-2,15-dihydroxy-3-(4-hydroxybutylsulfanyl)-7-methyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one |
|---|---|
| PubChem CID | 10937921 |
| Molecular Formula | C20H34O5S |
| Molecular Weight | 386.55 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (1R,2S,3R,7S,11E,13S,15S)-2,15-dihydroxy-3-(4-hydroxybutylsulfanyl)-7-methyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one |
| SMILES | C[C@H]1CCC/C=C/[C@@H]2C[C@H](O)C[C@H]2[C@H](O)[C@H](SCCCCO)CC(=O)O1 |
| InChI | InChI=1S/C20H34O5S/c1-14-7-3-2-4-8-15-11-16(22)12-17(15)20(24)18(13-19(23)25-14)26-10-6-5-9-21/h4,8,14-18,20-22,24H,2-3,5-7,9-13H2,1H3/b8-4+/t14-,15+,16-,17+,18+,20-/m0/s1 |
| InChIKey | NZGUMCZAKJOCSW-QYUFDEMSSA-N |
| XLogP | 2.67 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.55 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|