C7H10O4 — CID 130757545
(3aS,5R,6S,6aR)-5,6-dihydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 130757545) has the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. Its IUPAC name is (3aS,5R,6S,6aR)-5,6-dihydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aS,5R,6S,6aR)-5,6-dihydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 130757545 |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | (3aS,5R,6S,6aR)-5,6-dihydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | O=C1C[C@@H]2C[C@@H](O)[C@H](O)[C@@H]2O1 |
| InChI | InChI=1S/C7H10O4/c8-4-1-3-2-5(9)11-7(3)6(4)10/h3-4,6-8,10H,1-2H2/t3-,4+,6-,7+/m0/s1 |
| InChIKey | DGGGPQCJIGRSCH-VYFZPWGTSA-N |
| XLogP | -0.96 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |