About 2-methyl-4,9-dioxatricyclo[5.2.1.03,8]decan-5-one
2-methyl-4,9-dioxatricyclo[5.2.1.03,8]decan-5-one (PubChem CID 89021487) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is 2-methyl-4,9-dioxatricyclo[5.2.1.03,8]decan-5-one.
Molecular Properties
| Compound Name | 2-methyl-4,9-dioxatricyclo[5.2.1.03,8]decan-5-one |
| PubChem CID | 89021487 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 2-methyl-4,9-dioxatricyclo[5.2.1.03,8]decan-5-one |
| SMILES | CC1C2CC3CC(=O)OC1C3O2 |
| InChI | InChI=1S/C9H12O3/c1-4-6-2-5-3-7(10)12-8(4)9(5)11-6/h4-6,8-9H,2-3H2,1H3 |
| InChIKey | LYLQMQPAMIWXHF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-4,9-dioxatricyclo[5.2.1.03,8]decan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,9-dioxatricyclo[5.2.1.03,8]decan-5-one?
The IUPAC name of 2-methyl-4,9-dioxatricyclo[5.2.1.03,8]decan-5-one (CID 89021487) is 2-methyl-4,9-dioxatricyclo[5.2.1.03,8]decan-5-one.
What is the SMILES notation for 2-methyl-4,9-dioxatricyclo[5.2.1.03,8]decan-5-one?
The canonical SMILES for 2-methyl-4,9-dioxatricyclo[5.2.1.03,8]decan-5-one is CC1C2CC3CC(=O)OC1C3O2.
What is the InChIKey of 2-methyl-4,9-dioxatricyclo[5.2.1.03,8]decan-5-one?
The InChIKey is LYLQMQPAMIWXHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3/c1-4-6-2-5-3-7(10)12-8(4)9(5)11-6/h4-6,8-9H,2-3H2,1H3.
What are the key properties of 2-methyl-4,9-dioxatricyclo[5.2.1.03,8]decan-5-one?
2-methyl-4,9-dioxatricyclo[5.2.1.03,8]decan-5-one has a molecular weight of 168.19 g/mol, XLogP of 0.73, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,9-dioxatricyclo[5.2.1.03,8]decan-5-one is sourced from PubChem (CID 89021487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).