C9H12O2 — CID 11040886
(1S,2R,6S,7R)-3-oxatricyclo[5.2.1.02,6]decan-4-one (PubChem CID 11040886) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is (1S,2R,6S,7R)-3-oxatricyclo[5.2.1.02,6]decan-4-one.
| Compound Name | (1S,2R,6S,7R)-3-oxatricyclo[5.2.1.02,6]decan-4-one |
|---|---|
| PubChem CID | 11040886 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | (1S,2R,6S,7R)-3-oxatricyclo[5.2.1.02,6]decan-4-one |
| SMILES | O=C1C[C@H]2[C@@H]3CC[C@@H](C3)[C@H]2O1 |
| InChI | InChI=1S/C9H12O2/c10-8-4-7-5-1-2-6(3-5)9(7)11-8/h5-7,9H,1-4H2/t5-,6+,7+,9-/m1/s1 |
| InChIKey | BIASPHNGXKFEPM-UTSKPXGSSA-N |
| XLogP | 1.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |