C9H13IO2 — CID 132933654
(7R)-7-iodo-4-methyl-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one (PubChem CID 132933654) has the molecular formula C9H13IO2 and a molecular weight of 280.11 g/mol. Its IUPAC name is (7R)-7-iodo-4-methyl-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one.
| Compound Name | (7R)-7-iodo-4-methyl-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 132933654 |
| Molecular Formula | C9H13IO2 |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | (7R)-7-iodo-4-methyl-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one |
| SMILES | CC1CC[C@@H](I)C2OC(=O)CC12 |
| InChI | InChI=1S/C9H13IO2/c1-5-2-3-7(10)9-6(5)4-8(11)12-9/h5-7,9H,2-4H2,1H3/t5?,6?,7-,9?/m1/s1 |
| InChIKey | AINQRSMIIHSQII-WVUHZJBPSA-N |
| XLogP | 2.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|