C7H8O5 — CID 130765315
(3S,3aR,6R,6aS)-3,6-dihydroxy-3a,4,6,6a-tetrahydro-3H-cyclopenta[b]furan-2,5-dione (PubChem CID 130765315) has the molecular formula C7H8O5 and a molecular weight of 172.14 g/mol. Its IUPAC name is (3S,3aR,6R,6aS)-3,6-dihydroxy-3a,4,6,6a-tetrahydro-3H-cyclopenta[b]furan-2,5-dione.
| Compound Name | (3S,3aR,6R,6aS)-3,6-dihydroxy-3a,4,6,6a-tetrahydro-3H-cyclopenta[b]furan-2,5-dione |
|---|---|
| PubChem CID | 130765315 |
| Molecular Formula | C7H8O5 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | (3S,3aR,6R,6aS)-3,6-dihydroxy-3a,4,6,6a-tetrahydro-3H-cyclopenta[b]furan-2,5-dione |
| SMILES | O=C1O[C@H]2[C@H](CC(=O)[C@@H]2O)[C@@H]1O |
| InChI | InChI=1S/C7H8O5/c8-3-1-2-4(9)7(11)12-6(2)5(3)10/h2,4-6,9-10H,1H2/t2-,4+,5+,6+/m1/s1 |
| InChIKey | FZOUWLNNWMWNIL-JSTMLOLSSA-N |
| XLogP | -1.78 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |