C5H8O6 — CID 135075644
(5S)-3,4,5,6-tetrahydroxyoxan-2-one (PubChem CID 135075644) has the molecular formula C5H8O6 and a molecular weight of 164.11 g/mol. Its IUPAC name is (5S)-3,4,5,6-tetrahydroxyoxan-2-one.
| Compound Name | (5S)-3,4,5,6-tetrahydroxyoxan-2-one |
|---|---|
| PubChem CID | 135075644 |
| Molecular Formula | C5H8O6 |
| Molecular Weight | 164.11 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | (5S)-3,4,5,6-tetrahydroxyoxan-2-one |
| SMILES | O=C1OC(O)[C@@H](O)C(O)C1O |
| InChI | InChI=1S/C5H8O6/c6-1-2(7)4(9)11-5(10)3(1)8/h1-4,6-9H/t1?,2-,3?,4?/m0/s1 |
| InChIKey | XBDKENMSFLJFKG-DRSJPZNZSA-N |
| XLogP | -3.06 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.11 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |