C7H12O5 — CID 123675946
6-ethyl-3,4,5-trihydroxyoxan-2-one (PubChem CID 123675946) has the molecular formula C7H12O5 and a molecular weight of 176.17 g/mol. Its IUPAC name is 6-ethyl-3,4,5-trihydroxyoxan-2-one.
| Compound Name | 6-ethyl-3,4,5-trihydroxyoxan-2-one |
|---|---|
| PubChem CID | 123675946 |
| Molecular Formula | C7H12O5 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 6-ethyl-3,4,5-trihydroxyoxan-2-one |
| SMILES | CCC1OC(=O)C(O)C(O)C1O |
| InChI | InChI=1S/C7H12O5/c1-2-3-4(8)5(9)6(10)7(11)12-3/h3-6,8-10H,2H2,1H3 |
| InChIKey | QEVRZKWETOXYSR-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |