About 6-ethyl-3,4,5-trihydroxyoxan-2-one
6-ethyl-3,4,5-trihydroxyoxan-2-one (PubChem CID 123675946) has the molecular formula C7H12O5
and a molecular weight of 176.17 g/mol. Its IUPAC name is 6-ethyl-3,4,5-trihydroxyoxan-2-one.
Molecular Properties
| Compound Name | 6-ethyl-3,4,5-trihydroxyoxan-2-one |
| PubChem CID | 123675946 |
| Molecular Formula | C7H12O5 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 6-ethyl-3,4,5-trihydroxyoxan-2-one |
| SMILES | CCC1OC(=O)C(O)C(O)C1O |
| InChI | InChI=1S/C7H12O5/c1-2-3-4(8)5(9)6(10)7(11)12-3/h3-6,8-10H,2H2,1H3 |
| InChIKey | QEVRZKWETOXYSR-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-ethyl-3,4,5-trihydroxyoxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-3,4,5-trihydroxyoxan-2-one?
The IUPAC name of 6-ethyl-3,4,5-trihydroxyoxan-2-one (CID 123675946) is 6-ethyl-3,4,5-trihydroxyoxan-2-one.
What is the SMILES notation for 6-ethyl-3,4,5-trihydroxyoxan-2-one?
The canonical SMILES for 6-ethyl-3,4,5-trihydroxyoxan-2-one is CCC1OC(=O)C(O)C(O)C1O.
What is the InChIKey of 6-ethyl-3,4,5-trihydroxyoxan-2-one?
The InChIKey is QEVRZKWETOXYSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O5/c1-2-3-4(8)5(9)6(10)7(11)12-3/h3-6,8-10H,2H2,1H3.
What are the key properties of 6-ethyl-3,4,5-trihydroxyoxan-2-one?
6-ethyl-3,4,5-trihydroxyoxan-2-one has a molecular weight of 176.17 g/mol, XLogP of -1.60, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-3,4,5-trihydroxyoxan-2-one is sourced from PubChem (CID 123675946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).