About 5-(bromomethyl)-3,4-dihydroxyoxolan-2-one
5-(bromomethyl)-3,4-dihydroxyoxolan-2-one (PubChem CID 75089328) has the molecular formula C5H7BrO4
and a molecular weight of 211.01 g/mol. Its IUPAC name is 5-(bromomethyl)-3,4-dihydroxyoxolan-2-one.
Molecular Properties
| Compound Name | 5-(bromomethyl)-3,4-dihydroxyoxolan-2-one |
| PubChem CID | 75089328 |
| Molecular Formula | C5H7BrO4 |
| Molecular Weight | 211.01 g/mol |
| Exact Mass | 209.95 |
| IUPAC Name | 5-(bromomethyl)-3,4-dihydroxyoxolan-2-one |
| SMILES | O=C1OC(CBr)C(O)C1O |
| InChI | InChI=1S/C5H7BrO4/c6-1-2-3(7)4(8)5(9)10-2/h2-4,7-8H,1H2 |
| InChIKey | MYRODPRKOYUJTI-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.01 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(bromomethyl)-3,4-dihydroxyoxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(bromomethyl)-3,4-dihydroxyoxolan-2-one?
The IUPAC name of 5-(bromomethyl)-3,4-dihydroxyoxolan-2-one (CID 75089328) is 5-(bromomethyl)-3,4-dihydroxyoxolan-2-one.
What is the SMILES notation for 5-(bromomethyl)-3,4-dihydroxyoxolan-2-one?
The canonical SMILES for 5-(bromomethyl)-3,4-dihydroxyoxolan-2-one is O=C1OC(CBr)C(O)C1O.
What is the InChIKey of 5-(bromomethyl)-3,4-dihydroxyoxolan-2-one?
The InChIKey is MYRODPRKOYUJTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7BrO4/c6-1-2-3(7)4(8)5(9)10-2/h2-4,7-8H,1H2.
What are the key properties of 5-(bromomethyl)-3,4-dihydroxyoxolan-2-one?
5-(bromomethyl)-3,4-dihydroxyoxolan-2-one has a molecular weight of 211.01 g/mol, XLogP of -0.97, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(bromomethyl)-3,4-dihydroxyoxolan-2-one is sourced from PubChem (CID 75089328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).