C5H7BrO4 — CID 75089328
5-(bromomethyl)-3,4-dihydroxyoxolan-2-one (PubChem CID 75089328) has the molecular formula C5H7BrO4 and a molecular weight of 211.01 g/mol. Its IUPAC name is 5-(bromomethyl)-3,4-dihydroxyoxolan-2-one.
| Compound Name | 5-(bromomethyl)-3,4-dihydroxyoxolan-2-one |
|---|---|
| PubChem CID | 75089328 |
| Molecular Formula | C5H7BrO4 |
| Molecular Weight | 211.01 g/mol |
| Exact Mass | 209.95 |
| IUPAC Name | 5-(bromomethyl)-3,4-dihydroxyoxolan-2-one |
| SMILES | O=C1OC(CBr)C(O)C1O |
| InChI | InChI=1S/C5H7BrO4/c6-1-2-3(7)4(8)5(9)10-2/h2-4,7-8H,1H2 |
| InChIKey | MYRODPRKOYUJTI-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.01 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|