C8H12O4 — CID 130918136
(3S,4S,5S)-5-but-3-enyl-3,4-dihydroxyoxolan-2-one (PubChem CID 130918136) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is (3S,4S,5S)-5-but-3-enyl-3,4-dihydroxyoxolan-2-one.
| Compound Name | (3S,4S,5S)-5-but-3-enyl-3,4-dihydroxyoxolan-2-one |
|---|---|
| PubChem CID | 130918136 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (3S,4S,5S)-5-but-3-enyl-3,4-dihydroxyoxolan-2-one |
| SMILES | C=CCC[C@@H]1OC(=O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H12O4/c1-2-3-4-5-6(9)7(10)8(11)12-5/h2,5-7,9-10H,1,3-4H2/t5-,6+,7-/m0/s1 |
| InChIKey | LCVLEPJTXDZCQR-XVMARJQXSA-N |
| XLogP | -0.40 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|