C6H11O9P — CID 6398616
[(3S,4R)-3,4,5-trihydroxy-6-oxooxan-2-yl]methyl dihydrogen phosphate (PubChem CID 6398616) has the molecular formula C6H11O9P and a molecular weight of 258.12 g/mol. Its IUPAC name is [(3S,4R)-3,4,5-trihydroxy-6-oxooxan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(3S,4R)-3,4,5-trihydroxy-6-oxooxan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 6398616 |
| Molecular Formula | C6H11O9P |
| Molecular Weight | 258.12 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | [(3S,4R)-3,4,5-trihydroxy-6-oxooxan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=C1OC(COP(=O)(O)O)[C@@H](O)[C@@H](O)C1O |
| InChI | InChI=1S/C6H11O9P/c7-3-2(1-14-16(11,12)13)15-6(10)5(9)4(3)8/h2-5,7-9H,1H2,(H2,11,12,13)/t2?,3-,4-,5?/m1/s1 |
| InChIKey | IJOJIVNDFQSGAB-UUUZDELHSA-N |
| XLogP | -2.90 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.12 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|