C6H10O6 — CID 140782295
(3R,4S,5S,6E)-6-(hydroxymethylidene)oxane-2,3,4,5-tetrol (PubChem CID 140782295) has the molecular formula C6H10O6 and a molecular weight of 178.14 g/mol. Its IUPAC name is (3R,4S,5S,6E)-6-(hydroxymethylidene)oxane-2,3,4,5-tetrol.
| Compound Name | (3R,4S,5S,6E)-6-(hydroxymethylidene)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 140782295 |
| Molecular Formula | C6H10O6 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | (3R,4S,5S,6E)-6-(hydroxymethylidene)oxane-2,3,4,5-tetrol |
| SMILES | O/C=C1/OC(O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H10O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h1,3-11H/b2-1+/t3-,4+,5-,6?/m1/s1 |
| InChIKey | FGUXWAAERRVOAV-RCHDPMAWSA-N |
| XLogP | -2.18 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|