C7H12O5 — CID 67680565
(3R,4S,5S)-3-methoxy-6-methylideneoxane-2,4,5-triol (PubChem CID 67680565) has the molecular formula C7H12O5 and a molecular weight of 176.17 g/mol. Its IUPAC name is (3R,4S,5S)-3-methoxy-6-methylideneoxane-2,4,5-triol.
| Compound Name | (3R,4S,5S)-3-methoxy-6-methylideneoxane-2,4,5-triol |
|---|---|
| PubChem CID | 67680565 |
| Molecular Formula | C7H12O5 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | (3R,4S,5S)-3-methoxy-6-methylideneoxane-2,4,5-triol |
| SMILES | C=C1OC(O)[C@H](OC)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H12O5/c1-3-4(8)5(9)6(11-2)7(10)12-3/h4-10H,1H2,2H3/t4-,5+,6-,7?/m1/s1 |
| InChIKey | GRVWIIJCMPFKHE-JFRCYRBUSA-N |
| XLogP | -1.41 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |