C7H12O5 — CID 130831191
(1S,2S,3R,4S,5R,6S)-5-methoxy-7-oxabicyclo[4.1.0]heptane-2,3,4-triol (PubChem CID 130831191) has the molecular formula C7H12O5 and a molecular weight of 176.17 g/mol. Its IUPAC name is (1S,2S,3R,4S,5R,6S)-5-methoxy-7-oxabicyclo[4.1.0]heptane-2,3,4-triol.
| Compound Name | (1S,2S,3R,4S,5R,6S)-5-methoxy-7-oxabicyclo[4.1.0]heptane-2,3,4-triol |
|---|---|
| PubChem CID | 130831191 |
| Molecular Formula | C7H12O5 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | (1S,2S,3R,4S,5R,6S)-5-methoxy-7-oxabicyclo[4.1.0]heptane-2,3,4-triol |
| SMILES | CO[C@@H]1[C@@H](O)[C@@H](O)[C@H](O)[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C7H12O5/c1-11-5-3(9)2(8)4(10)6-7(5)12-6/h2-10H,1H3/t2-,3+,4+,5-,6+,7-/m1/s1 |
| InChIKey | ZZFXHPYMGJJZKZ-URFJBAFZSA-N |
| XLogP | -2.13 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|