C8H12O6 — CID 11333170
(1R,5S,6S,8R)-9-methoxy-2,4,10-trioxatricyclo[3.3.1.13,7]decane-6,8-diol (PubChem CID 11333170) has the molecular formula C8H12O6 and a molecular weight of 204.18 g/mol. Its IUPAC name is (1R,5S,6S,8R)-9-methoxy-2,4,10-trioxatricyclo[3.3.1.13,7]decane-6,8-diol.
| Compound Name | (1R,5S,6S,8R)-9-methoxy-2,4,10-trioxatricyclo[3.3.1.13,7]decane-6,8-diol |
|---|---|
| PubChem CID | 11333170 |
| Molecular Formula | C8H12O6 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | (1R,5S,6S,8R)-9-methoxy-2,4,10-trioxatricyclo[3.3.1.13,7]decane-6,8-diol |
| SMILES | COC1[C@H]2OC3OC([C@@H](O)[C@H]1O3)[C@@H]2O |
| InChI | InChI=1S/C8H12O6/c1-11-7-5-2(9)4-3(10)6(7)14-8(12-4)13-5/h2-10H,1H3/t2-,3+,4?,5-,6+,7?,8? |
| InChIKey | MOXHWXBTMPIEGQ-BHURQIRWSA-N |
| XLogP | -1.80 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |