C7H12O4 — CID 122596436
(3S)-4-methoxy-3-methyl-2,7-dioxabicyclo[4.1.0]heptan-5-ol (PubChem CID 122596436) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is (3S)-4-methoxy-3-methyl-2,7-dioxabicyclo[4.1.0]heptan-5-ol.
| Compound Name | (3S)-4-methoxy-3-methyl-2,7-dioxabicyclo[4.1.0]heptan-5-ol |
|---|---|
| PubChem CID | 122596436 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | (3S)-4-methoxy-3-methyl-2,7-dioxabicyclo[4.1.0]heptan-5-ol |
| SMILES | COC1C(O)C2OC2O[C@H]1C |
| InChI | InChI=1S/C7H12O4/c1-3-5(9-2)4(8)6-7(10-3)11-6/h3-8H,1-2H3/t3-,4?,5?,6?,7?/m0/s1 |
| InChIKey | DVOYYGUABJWAQP-XCASYZLESA-N |
| XLogP | -0.49 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|