C8H16O5 — CID 130928120
(2S,3R,4S,5R,6R)-3,4-dimethoxy-6-methyloxane-2,5-diol (PubChem CID 130928120) has the molecular formula C8H16O5 and a molecular weight of 192.21 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-3,4-dimethoxy-6-methyloxane-2,5-diol.
| Compound Name | (2S,3R,4S,5R,6R)-3,4-dimethoxy-6-methyloxane-2,5-diol |
|---|---|
| PubChem CID | 130928120 |
| Molecular Formula | C8H16O5 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | (2S,3R,4S,5R,6R)-3,4-dimethoxy-6-methyloxane-2,5-diol |
| SMILES | CO[C@@H]1[C@@H](OC)[C@H](O)[C@@H](C)O[C@@H]1O |
| InChI | InChI=1S/C8H16O5/c1-4-5(9)6(11-2)7(12-3)8(10)13-4/h4-10H,1-3H3/t4-,5-,6+,7-,8+/m1/s1 |
| InChIKey | SXWBIRCAXZNEGK-CBQIKETKSA-N |
| XLogP | -0.89 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |