C9H18O4 — CID 129044484
(3S,4R,5S,6S)-4,5-dimethoxy-2,6-dimethyloxan-3-ol (PubChem CID 129044484) has the molecular formula C9H18O4 and a molecular weight of 190.24 g/mol. Its IUPAC name is (3S,4R,5S,6S)-4,5-dimethoxy-2,6-dimethyloxan-3-ol.
| Compound Name | (3S,4R,5S,6S)-4,5-dimethoxy-2,6-dimethyloxan-3-ol |
|---|---|
| PubChem CID | 129044484 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | (3S,4R,5S,6S)-4,5-dimethoxy-2,6-dimethyloxan-3-ol |
| SMILES | CO[C@@H]1[C@H](OC)[C@@H](O)C(C)O[C@H]1C |
| InChI | InChI=1S/C9H18O4/c1-5-7(10)9(12-4)8(11-3)6(2)13-5/h5-10H,1-4H3/t5?,6-,7-,8-,9+/m0/s1 |
| InChIKey | BBGFTQCERXPALH-BQNZPOLKSA-N |
| XLogP | 0.18 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |