C11H24O5 — CID 142172396
ethane;(2R,5S)-3,4,5-trimethoxy-6-methyloxan-2-ol (PubChem CID 142172396) has the molecular formula C11H24O5 and a molecular weight of 236.31 g/mol. Its IUPAC name is ethane;(2R,5S)-3,4,5-trimethoxy-6-methyloxan-2-ol.
| Compound Name | ethane;(2R,5S)-3,4,5-trimethoxy-6-methyloxan-2-ol |
|---|---|
| PubChem CID | 142172396 |
| Molecular Formula | C11H24O5 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | ethane;(2R,5S)-3,4,5-trimethoxy-6-methyloxan-2-ol |
| SMILES | CC.COC1C(OC)[C@H](O)OC(C)[C@@H]1OC |
| InChI | InChI=1S/C9H18O5.C2H6/c1-5-6(11-2)7(12-3)8(13-4)9(10)14-5;1-2/h5-10H,1-4H3;1-2H3/t5?,6-,7?,8?,9+;/m0./s1 |
| InChIKey | UWHLPCYBTFUUKN-OMCIRFFZSA-N |
| XLogP | 0.79 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |