C9H17FO4 — CID 134895222
(3R,4R,5S,6S)-2-fluoro-3,4,5-trimethoxy-6-methyloxane (PubChem CID 134895222) has the molecular formula C9H17FO4 and a molecular weight of 208.23 g/mol. Its IUPAC name is (3R,4R,5S,6S)-2-fluoro-3,4,5-trimethoxy-6-methyloxane.
| Compound Name | (3R,4R,5S,6S)-2-fluoro-3,4,5-trimethoxy-6-methyloxane |
|---|---|
| PubChem CID | 134895222 |
| Molecular Formula | C9H17FO4 |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (3R,4R,5S,6S)-2-fluoro-3,4,5-trimethoxy-6-methyloxane |
| SMILES | CO[C@@H]1[C@@H](OC)[C@@H](OC)C(F)O[C@H]1C |
| InChI | InChI=1S/C9H17FO4/c1-5-6(11-2)7(12-3)8(13-4)9(10)14-5/h5-9H,1-4H3/t5-,6-,7+,8+,9?/m0/s1 |
| InChIKey | YEIGUXKKVGWSAF-WMOCKQOXSA-N |
| XLogP | 0.75 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |