C9H19NO5 — CID 91296350
N-(3,4,5-trimethoxy-6-methyloxan-2-yl)hydroxylamine (PubChem CID 91296350) has the molecular formula C9H19NO5 and a molecular weight of 221.25 g/mol. Its IUPAC name is N-(3,4,5-trimethoxy-6-methyloxan-2-yl)hydroxylamine.
| Compound Name | N-(3,4,5-trimethoxy-6-methyloxan-2-yl)hydroxylamine |
|---|---|
| PubChem CID | 91296350 |
| Molecular Formula | C9H19NO5 |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | N-(3,4,5-trimethoxy-6-methyloxan-2-yl)hydroxylamine |
| SMILES | COC1C(C)OC(NO)C(OC)C1OC |
| InChI | InChI=1S/C9H19NO5/c1-5-6(12-2)7(13-3)8(14-4)9(10-11)15-5/h5-11H,1-4H3 |
| InChIKey | NNLDSJBAAWHXQZ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|