C9H17IO4 — CID 160900646
(3S,4R,5R,6S)-2-iodo-3,4,5-trimethoxy-6-methyloxane (PubChem CID 160900646) has the molecular formula C9H17IO4 and a molecular weight of 316.14 g/mol. Its IUPAC name is (3S,4R,5R,6S)-2-iodo-3,4,5-trimethoxy-6-methyloxane.
| Compound Name | (3S,4R,5R,6S)-2-iodo-3,4,5-trimethoxy-6-methyloxane |
|---|---|
| PubChem CID | 160900646 |
| Molecular Formula | C9H17IO4 |
| Molecular Weight | 316.14 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | (3S,4R,5R,6S)-2-iodo-3,4,5-trimethoxy-6-methyloxane |
| SMILES | CO[C@@H]1[C@H](OC)[C@H](C)OC(I)[C@H]1OC |
| InChI | InChI=1S/C9H17IO4/c1-5-6(11-2)7(12-3)8(13-4)9(10)14-5/h5-9H,1-4H3/t5-,6+,7+,8-,9?/m0/s1 |
| InChIKey | SPLKOHYDHDOORH-WAOFTFCCSA-N |
| XLogP | 1.21 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.14 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|