C11H22O5 — CID 20816384
3,5-dimethoxy-4-(methoxymethoxy)-2,6-dimethyloxane (PubChem CID 20816384) has the molecular formula C11H22O5 and a molecular weight of 234.29 g/mol. Its IUPAC name is 3,5-dimethoxy-4-(methoxymethoxy)-2,6-dimethyloxane.
| Compound Name | 3,5-dimethoxy-4-(methoxymethoxy)-2,6-dimethyloxane |
|---|---|
| PubChem CID | 20816384 |
| Molecular Formula | C11H22O5 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 3,5-dimethoxy-4-(methoxymethoxy)-2,6-dimethyloxane |
| SMILES | COCOC1C(OC)C(C)OC(C)C1OC |
| InChI | InChI=1S/C11H22O5/c1-7-9(13-4)11(15-6-12-3)10(14-5)8(2)16-7/h7-11H,6H2,1-5H3 |
| InChIKey | VPCAXJMFPHGFRV-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|