C11H22O4 — CID 163737733
(2S,3S,5S,6R)-4-ethoxy-3,5-dimethoxy-2,6-dimethyloxane (PubChem CID 163737733) has the molecular formula C11H22O4 and a molecular weight of 218.29 g/mol. Its IUPAC name is (2S,3S,5S,6R)-4-ethoxy-3,5-dimethoxy-2,6-dimethyloxane.
| Compound Name | (2S,3S,5S,6R)-4-ethoxy-3,5-dimethoxy-2,6-dimethyloxane |
|---|---|
| PubChem CID | 163737733 |
| Molecular Formula | C11H22O4 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | (2S,3S,5S,6R)-4-ethoxy-3,5-dimethoxy-2,6-dimethyloxane |
| SMILES | CCOC1[C@@H](OC)[C@H](C)O[C@H](C)[C@@H]1OC |
| InChI | InChI=1S/C11H22O4/c1-6-14-11-9(12-4)7(2)15-8(3)10(11)13-5/h7-11H,6H2,1-5H3/t7-,8+,9-,10-,11?/m0/s1 |
| InChIKey | OUXZSSPMHRGXFT-JRALQKAMSA-N |
| XLogP | 1.23 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |