C26H33NO6 — CID 59441480
[(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl] N-[4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]carbamate (PubChem CID 59441480) has the molecular formula C26H33NO6 and a molecular weight of 455.55 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl] N-[4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]carbamate.
| Compound Name | [(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl] N-[4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]carbamate |
|---|---|
| PubChem CID | 59441480 |
| Molecular Formula | C26H33NO6 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | [(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl] N-[4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]carbamate |
| SMILES | CCO[C@@H]1[C@@H](OC)[C@H](C)O[C@@H](OC(=O)Nc2ccc(/C=C/c3ccc(C)cc3)cc2)[C@@H]1OC |
| InChI | InChI=1S/C26H33NO6/c1-6-31-23-22(29-4)18(3)32-25(24(23)30-5)33-26(28)27-21-15-13-20(14-16-21)12-11-19-9-7-17(2)8-10-19/h7-16,18,22-25H,6H2,1-5H3,(H,27,28)/b12-11+/t18-,22-,23+,24+,25-/m0/s1 |
| InChIKey | RWDAMCFJEMBVLW-NPBZCXDFSA-N |
| XLogP | 4.89 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|