C27H30F3N3O8 — CID 122576444
[(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl] N-[4-[2-oxo-3-[4-(trifluoromethoxy)phenyl]imidazol-1-yl]phenyl]carbamate (PubChem CID 122576444) has the molecular formula C27H30F3N3O8 and a molecular weight of 581.54 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl] N-[4-[2-oxo-3-[4-(trifluoromethoxy)phenyl]imidazol-1-yl]phenyl]carbamate.
| Compound Name | [(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl] N-[4-[2-oxo-3-[4-(trifluoromethoxy)phenyl]imidazol-1-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 122576444 |
| Molecular Formula | C27H30F3N3O8 |
| Molecular Weight | 581.54 g/mol |
| Exact Mass | 581.20 |
| IUPAC Name | [(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl] N-[4-[2-oxo-3-[4-(trifluoromethoxy)phenyl]imidazol-1-yl]phenyl]carbamate |
| SMILES | CCO[C@@H]1[C@@H](OC)[C@H](C)O[C@@H](OC(=O)Nc2ccc(-n3ccn(-c4ccc(OC(F)(F)F)cc4)c3=O)cc2)[C@@H]1OC |
| InChI | InChI=1S/C27H30F3N3O8/c1-5-38-22-21(36-3)16(2)39-24(23(22)37-4)40-25(34)31-17-6-8-18(9-7-17)32-14-15-33(26(32)35)19-10-12-20(13-11-19)41-27(28,29)30/h6-16,21-24H,5H2,1-4H3,(H,31,34)/t16-,21-,22+,23+,24-/m0/s1 |
| InChIKey | DRVHHDKFZIHDOZ-FYICKDKOSA-N |
| XLogP | 4.26 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |