C32H35F5N4O10 — CID 87430423
methyl 4-[N-[(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl]oxycarbonyl-4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]anilino]-4-oxobutanoate (PubChem CID 87430423) has the molecular formula C32H35F5N4O10 and a molecular weight of 730.64 g/mol. Its IUPAC name is methyl 4-[N-[(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl]oxycarbonyl-4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]anilino]-4-oxobutanoate.
| Compound Name | methyl 4-[N-[(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl]oxycarbonyl-4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 87430423 |
| Molecular Formula | C32H35F5N4O10 |
| Molecular Weight | 730.64 g/mol |
| Exact Mass | 730.23 |
| IUPAC Name | methyl 4-[N-[(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl]oxycarbonyl-4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]anilino]-4-oxobutanoate |
| SMILES | CCO[C@@H]1[C@@H](OC)[C@H](C)O[C@@H](OC(=O)N(C(=O)CCC(=O)OC)c2ccc(-c3ncn(-c4ccc(OC(F)(F)C(F)(F)F)cc4)n3)cc2)[C@@H]1OC |
| InChI | InChI=1S/C32H35F5N4O10/c1-6-48-26-25(46-4)18(2)49-29(27(26)47-5)50-30(44)41(23(42)15-16-24(43)45-3)21-9-7-19(8-10-21)28-38-17-40(39-28)20-11-13-22(14-12-20)51-32(36,37)31(33,34)35/h7-14,17-18,25-27,29H,6,15-16H2,1-5H3/t18-,25-,26+,27+,29-/m0/s1 |
| InChIKey | JUARGQATTAGIDB-NPTYGGMKSA-N |
| XLogP | 5.07 |
| TPSA | 149.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.64 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|