C29H31F7N4O7 — CID 122576640
[(2S,3R,4R,5S,6S)-3,5-dimethoxy-6-methyl-4-propoxyoxan-2-yl] N-[4-[1-[4-(1,1,2,2,3,3,3-heptafluoropropoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamate (PubChem CID 122576640) has the molecular formula C29H31F7N4O7 and a molecular weight of 680.57 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6S)-3,5-dimethoxy-6-methyl-4-propoxyoxan-2-yl] N-[4-[1-[4-(1,1,2,2,3,3,3-heptafluoropropoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamate.
| Compound Name | [(2S,3R,4R,5S,6S)-3,5-dimethoxy-6-methyl-4-propoxyoxan-2-yl] N-[4-[1-[4-(1,1,2,2,3,3,3-heptafluoropropoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 122576640 |
| Molecular Formula | C29H31F7N4O7 |
| Molecular Weight | 680.57 g/mol |
| Exact Mass | 680.21 |
| IUPAC Name | [(2S,3R,4R,5S,6S)-3,5-dimethoxy-6-methyl-4-propoxyoxan-2-yl] N-[4-[1-[4-(1,1,2,2,3,3,3-heptafluoropropoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamate |
| SMILES | CCCO[C@@H]1[C@@H](OC)[C@H](C)O[C@@H](OC(=O)Nc2ccc(-c3ncn(-c4ccc(OC(F)(F)C(F)(F)C(F)(F)F)cc4)n3)cc2)[C@@H]1OC |
| InChI | InChI=1S/C29H31F7N4O7/c1-5-14-44-22-21(42-3)16(2)45-25(23(22)43-4)46-26(41)38-18-8-6-17(7-9-18)24-37-15-40(39-24)19-10-12-20(13-11-19)47-29(35,36)27(30,31)28(32,33)34/h6-13,15-16,21-23,25H,5,14H2,1-4H3,(H,38,41)/t16-,21-,22+,23+,25-/m0/s1 |
| InChIKey | UTRXBIOUDDJRAQ-IZKMSSHQSA-N |
| XLogP | 6.22 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.57 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|