C25H28F3N5O6 — CID 122576608
(E)-N-[(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl]oxy-1-[5-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]-2-pyridinyl]methanimine (PubChem CID 122576608) has the molecular formula C25H28F3N5O6 and a molecular weight of 551.52 g/mol. Its IUPAC name is (E)-N-[(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl]oxy-1-[5-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]-2-pyridinyl]methanimine.
| Compound Name | (E)-N-[(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl]oxy-1-[5-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]-2-pyridinyl]methanimine |
|---|---|
| PubChem CID | 122576608 |
| Molecular Formula | C25H28F3N5O6 |
| Molecular Weight | 551.52 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | (E)-N-[(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl]oxy-1-[5-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]-2-pyridinyl]methanimine |
| SMILES | CCO[C@@H]1[C@@H](OC)[C@H](C)O[C@@H](O/N=C/c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cn2)[C@@H]1OC |
| InChI | InChI=1S/C25H28F3N5O6/c1-5-36-21-20(34-3)15(2)37-24(22(21)35-4)39-31-13-17-7-6-16(12-29-17)23-30-14-33(32-23)18-8-10-19(11-9-18)38-25(26,27)28/h6-15,20-22,24H,5H2,1-4H3/b31-13+/t15-,20-,21+,22+,24-/m0/s1 |
| InChIKey | UQNMKJNDORBMIR-LFQWXADFSA-N |
| XLogP | 3.76 |
| TPSA | 111.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|