C27H30BrF3N4O7 — CID 162545854
[(2S,3R,4R,5R)-4-ethoxy-3,5-dimethoxy-6,6-dimethyloxan-2-yl] N-[2-bromo-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamate (PubChem CID 162545854) has the molecular formula C27H30BrF3N4O7 and a molecular weight of 659.46 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-4-ethoxy-3,5-dimethoxy-6,6-dimethyloxan-2-yl] N-[2-bromo-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamate.
| Compound Name | [(2S,3R,4R,5R)-4-ethoxy-3,5-dimethoxy-6,6-dimethyloxan-2-yl] N-[2-bromo-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 162545854 |
| Molecular Formula | C27H30BrF3N4O7 |
| Molecular Weight | 659.46 g/mol |
| Exact Mass | 658.12 |
| IUPAC Name | [(2S,3R,4R,5R)-4-ethoxy-3,5-dimethoxy-6,6-dimethyloxan-2-yl] N-[2-bromo-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamate |
| SMILES | CCO[C@@H]1C(OC)C(C)(C)O[C@@H](OC(=O)Nc2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2Br)[C@@H]1OC |
| InChI | InChI=1S/C27H30BrF3N4O7/c1-6-39-20-21(37-4)24(42-26(2,3)22(20)38-5)40-25(36)33-19-12-7-15(13-18(19)28)23-32-14-35(34-23)16-8-10-17(11-9-16)41-27(29,30)31/h7-14,20-22,24H,6H2,1-5H3,(H,33,36)/t20-,21+,22?,24+/m0/s1 |
| InChIKey | VDUMKSRZWZOXNE-ZYXZECGJSA-N |
| XLogP | 5.71 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.46 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |