C27H31F3N4O7 — CID 56848036
N-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methyl]-N-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxyacetamide (PubChem CID 56848036) has the molecular formula C27H31F3N4O7 and a molecular weight of 580.56 g/mol. Its IUPAC name is N-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methyl]-N-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxyacetamide.
| Compound Name | N-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methyl]-N-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxyacetamide |
|---|---|
| PubChem CID | 56848036 |
| Molecular Formula | C27H31F3N4O7 |
| Molecular Weight | 580.56 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | N-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methyl]-N-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxyacetamide |
| SMILES | CO[C@@H]1[C@@H](OC)[C@H](C)O[C@@H](ON(Cc2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)C(C)=O)[C@@H]1OC |
| InChI | InChI=1S/C27H31F3N4O7/c1-16-22(36-3)23(37-4)24(38-5)26(39-16)41-34(17(2)35)14-18-6-8-19(9-7-18)25-31-15-33(32-25)20-10-12-21(13-11-20)40-27(28,29)30/h6-13,15-16,22-24,26H,14H2,1-5H3/t16-,22-,23+,24+,26-/m0/s1 |
| InChIKey | QBBHPPIGJZHOCY-JVYKHFTMSA-N |
| XLogP | 3.90 |
| TPSA | 106.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|