C26H28F3N3O7 — CID 87430440
4-[1-[4-(trifluoromethoxy)phenyl]imidazol-4-yl]-N-[(2S,3S,4S,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxybenzamide (PubChem CID 87430440) has the molecular formula C26H28F3N3O7 and a molecular weight of 551.52 g/mol. Its IUPAC name is 4-[1-[4-(trifluoromethoxy)phenyl]imidazol-4-yl]-N-[(2S,3S,4S,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxybenzamide.
| Compound Name | 4-[1-[4-(trifluoromethoxy)phenyl]imidazol-4-yl]-N-[(2S,3S,4S,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxybenzamide |
|---|---|
| PubChem CID | 87430440 |
| Molecular Formula | C26H28F3N3O7 |
| Molecular Weight | 551.52 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | 4-[1-[4-(trifluoromethoxy)phenyl]imidazol-4-yl]-N-[(2S,3S,4S,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxybenzamide |
| SMILES | CO[C@@H]1[C@H](OC)[C@H](ONC(=O)c2ccc(-c3cn(-c4ccc(OC(F)(F)F)cc4)cn3)cc2)O[C@@H](C)[C@@H]1OC |
| InChI | InChI=1S/C26H28F3N3O7/c1-15-21(34-2)22(35-3)23(36-4)25(37-15)39-31-24(33)17-7-5-16(6-8-17)20-13-32(14-30-20)18-9-11-19(12-10-18)38-26(27,28)29/h5-15,21-23,25H,1-4H3,(H,31,33)/t15-,21-,22-,23-,25-/m0/s1 |
| InChIKey | GYRRFNMBYORUNC-YEOXESLPSA-N |
| XLogP | 3.89 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|