C28H32F2N2O6 — CID 122576597
(E)-1-[4-[1-[4-(1,1-difluoroethoxy)phenyl]pyrrol-3-yl]phenyl]-N-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxymethanimine (PubChem CID 122576597) has the molecular formula C28H32F2N2O6 and a molecular weight of 530.57 g/mol. Its IUPAC name is (E)-1-[4-[1-[4-(1,1-difluoroethoxy)phenyl]pyrrol-3-yl]phenyl]-N-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxymethanimine.
| Compound Name | (E)-1-[4-[1-[4-(1,1-difluoroethoxy)phenyl]pyrrol-3-yl]phenyl]-N-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxymethanimine |
|---|---|
| PubChem CID | 122576597 |
| Molecular Formula | C28H32F2N2O6 |
| Molecular Weight | 530.57 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | (E)-1-[4-[1-[4-(1,1-difluoroethoxy)phenyl]pyrrol-3-yl]phenyl]-N-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxymethanimine |
| SMILES | CO[C@@H]1[C@@H](OC)[C@H](C)O[C@@H](O/N=C/c2ccc(-c3ccn(-c4ccc(OC(C)(F)F)cc4)c3)cc2)[C@@H]1OC |
| InChI | InChI=1S/C28H32F2N2O6/c1-18-24(33-3)25(34-4)26(35-5)27(36-18)38-31-16-19-6-8-20(9-7-19)21-14-15-32(17-21)22-10-12-23(13-11-22)37-28(2,29)30/h6-18,24-27H,1-5H3/b31-16+/t18-,24-,25+,26+,27-/m0/s1 |
| InChIKey | LBRJPEZQZNFYFM-YNNSIMINSA-N |
| XLogP | 5.28 |
| TPSA | 72.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.57 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|