C26H27F3N2O5S — CID 122576436
(E)-1-[4-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]phenyl]-N-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxymethanimine (PubChem CID 122576436) has the molecular formula C26H27F3N2O5S and a molecular weight of 536.57 g/mol. Its IUPAC name is (E)-1-[4-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]phenyl]-N-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxymethanimine.
| Compound Name | (E)-1-[4-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]phenyl]-N-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxymethanimine |
|---|---|
| PubChem CID | 122576436 |
| Molecular Formula | C26H27F3N2O5S |
| Molecular Weight | 536.57 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | (E)-1-[4-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]phenyl]-N-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxymethanimine |
| SMILES | CO[C@@H]1[C@@H](OC)[C@H](C)O[C@@H](O/N=C/c2ccc(-c3csc(-c4ccc(C(F)(F)F)cc4)n3)cc2)[C@@H]1OC |
| InChI | InChI=1S/C26H27F3N2O5S/c1-15-21(32-2)22(33-3)23(34-4)25(35-15)36-30-13-16-5-7-17(8-6-16)20-14-37-24(31-20)18-9-11-19(12-10-18)26(27,28)29/h5-15,21-23,25H,1-4H3/b30-13+/t15-,21-,22+,23+,25-/m0/s1 |
| InChIKey | AITNVIDLQPLGPQ-SITJYBEUSA-N |
| XLogP | 5.64 |
| TPSA | 71.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.57 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|