C30H27F10N3O6 — CID 122576472
[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl] N-[4-[6-(1,1,2,2,3,3,3-heptafluoropropyl)-2-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]phenyl]carbamate (PubChem CID 122576472) has the molecular formula C30H27F10N3O6 and a molecular weight of 715.54 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl] N-[4-[6-(1,1,2,2,3,3,3-heptafluoropropyl)-2-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]phenyl]carbamate.
| Compound Name | [(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl] N-[4-[6-(1,1,2,2,3,3,3-heptafluoropropyl)-2-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 122576472 |
| Molecular Formula | C30H27F10N3O6 |
| Molecular Weight | 715.54 g/mol |
| Exact Mass | 715.17 |
| IUPAC Name | [(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl] N-[4-[6-(1,1,2,2,3,3,3-heptafluoropropyl)-2-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]phenyl]carbamate |
| SMILES | CO[C@@H]1[C@@H](OC)[C@H](C)O[C@@H](OC(=O)Nc2ccc(-c3cc(C(F)(F)C(F)(F)C(F)(F)F)nc(-c4ccc(C(F)(F)F)cc4)n3)cc2)[C@@H]1OC |
| InChI | InChI=1S/C30H27F10N3O6/c1-14-21(45-2)22(46-3)23(47-4)25(48-14)49-26(44)41-18-11-7-15(8-12-18)19-13-20(27(31,32)29(36,37)30(38,39)40)43-24(42-19)16-5-9-17(10-6-16)28(33,34)35/h5-14,21-23,25H,1-4H3,(H,41,44)/t14-,21-,22+,23+,25-/m0/s1 |
| InChIKey | WUBSYHKAHJJAHG-QBKOPDGJSA-N |
| XLogP | 7.46 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.54 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|