C25H30N4O7 — CID 130332303
[(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl] N-[4-[1-(4-hydroxyphenyl)-1,2,4-triazol-3-yl]phenyl]carbamate (PubChem CID 130332303) has the molecular formula C25H30N4O7 and a molecular weight of 498.54 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl] N-[4-[1-(4-hydroxyphenyl)-1,2,4-triazol-3-yl]phenyl]carbamate.
| Compound Name | [(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl] N-[4-[1-(4-hydroxyphenyl)-1,2,4-triazol-3-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 130332303 |
| Molecular Formula | C25H30N4O7 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | [(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl] N-[4-[1-(4-hydroxyphenyl)-1,2,4-triazol-3-yl]phenyl]carbamate |
| SMILES | CCO[C@@H]1[C@@H](OC)[C@H](C)O[C@@H](OC(=O)Nc2ccc(-c3ncn(-c4ccc(O)cc4)n3)cc2)[C@@H]1OC |
| InChI | InChI=1S/C25H30N4O7/c1-5-34-21-20(32-3)15(2)35-24(22(21)33-4)36-25(31)27-17-8-6-16(7-9-17)23-26-14-29(28-23)18-10-12-19(30)13-11-18/h6-15,20-22,24,30H,5H2,1-4H3,(H,27,31)/t15-,20-,21+,22+,24-/m0/s1 |
| InChIKey | GPJDHUBVIANQSJ-KIFABUDQSA-N |
| XLogP | 3.37 |
| TPSA | 126.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |