C27H31F3N2O7 — CID 122576646
[(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl] N-[4-[5-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazol-3-yl]phenyl]carbamate (PubChem CID 122576646) has the molecular formula C27H31F3N2O7 and a molecular weight of 552.55 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl] N-[4-[5-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazol-3-yl]phenyl]carbamate.
| Compound Name | [(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl] N-[4-[5-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazol-3-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 122576646 |
| Molecular Formula | C27H31F3N2O7 |
| Molecular Weight | 552.55 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | [(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl] N-[4-[5-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazol-3-yl]phenyl]carbamate |
| SMILES | CCO[C@@H]1[C@@H](OC)[C@H](C)O[C@@H](OC(=O)Nc2ccc(C3=NOC(c4ccc(C(F)(F)F)cc4)C3)cc2)[C@@H]1OC |
| InChI | InChI=1S/C27H31F3N2O7/c1-5-36-23-22(34-3)15(2)37-25(24(23)35-4)38-26(33)31-19-12-8-16(9-13-19)20-14-21(39-32-20)17-6-10-18(11-7-17)27(28,29)30/h6-13,15,21-25H,5,14H2,1-4H3,(H,31,33)/t15-,21?,22-,23+,24+,25-/m0/s1 |
| InChIKey | ZSYCDRWPJZEZLV-GZFCQKBTSA-N |
| XLogP | 5.30 |
| TPSA | 96.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |