C26H29F3N4O7 — CID 122576484
[(2R,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl] N-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamate (PubChem CID 122576484) has the molecular formula C26H29F3N4O7 and a molecular weight of 566.53 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl] N-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamate.
| Compound Name | [(2R,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl] N-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 122576484 |
| Molecular Formula | C26H29F3N4O7 |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl] N-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamate |
| SMILES | CCO[C@@H]1[C@@H](OC)[C@H](C)O[C@H](OC(=O)Nc2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)[C@@H]1OC |
| InChI | InChI=1S/C26H29F3N4O7/c1-5-37-21-20(35-3)15(2)38-24(22(21)36-4)39-25(34)31-17-8-6-16(7-9-17)23-30-14-33(32-23)18-10-12-19(13-11-18)40-26(27,28)29/h6-15,20-22,24H,5H2,1-4H3,(H,31,34)/t15-,20-,21+,22+,24+/m0/s1 |
| InChIKey | ALBHFIWZBKQNCB-XDUMEFLMSA-N |
| XLogP | 4.56 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |