About 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]-5-(trifluoromethyl)phenol
2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]-5-(trifluoromethyl)phenol (PubChem CID 146186096) has the molecular formula C17H12F3NO2S
and a molecular weight of 351.35 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]-5-(trifluoromethyl)phenol.
Molecular Properties
| Compound Name | 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]-5-(trifluoromethyl)phenol |
| PubChem CID | 146186096 |
| Molecular Formula | C17H12F3NO2S |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]-5-(trifluoromethyl)phenol |
| SMILES | COc1ccc(-c2nc(-c3ccc(C(F)(F)F)cc3O)cs2)cc1 |
| InChI | InChI=1S/C17H12F3NO2S/c1-23-12-5-2-10(3-6-12)16-21-14(9-24-16)13-7-4-11(8-15(13)22)17(18,19)20/h2-9,22H,1H3 |
| InChIKey | ZTBKGFSXFVPFBG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]-5-(trifluoromethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]-5-(trifluoromethyl)phenol?
The IUPAC name of 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]-5-(trifluoromethyl)phenol (CID 146186096) is 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]-5-(trifluoromethyl)phenol.
What is the SMILES notation for 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]-5-(trifluoromethyl)phenol?
The canonical SMILES for 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]-5-(trifluoromethyl)phenol is COc1ccc(-c2nc(-c3ccc(C(F)(F)F)cc3O)cs2)cc1.
What is the InChIKey of 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]-5-(trifluoromethyl)phenol?
The InChIKey is ZTBKGFSXFVPFBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12F3NO2S/c1-23-12-5-2-10(3-6-12)16-21-14(9-24-16)13-7-4-11(8-15(13)22)17(18,19)20/h2-9,22H,1H3.
What are the key properties of 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]-5-(trifluoromethyl)phenol?
2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]-5-(trifluoromethyl)phenol has a molecular weight of 351.35 g/mol, XLogP of 5.21, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]-5-(trifluoromethyl)phenol is sourced from PubChem (CID 146186096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).