C27H28F5N3O6 — CID 172933748
(E)-1-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]pyrazol-3-yl]phenyl]-N-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxymethanimine (PubChem CID 172933748) has the molecular formula C27H28F5N3O6 and a molecular weight of 585.53 g/mol. Its IUPAC name is (E)-1-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]pyrazol-3-yl]phenyl]-N-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxymethanimine.
| Compound Name | (E)-1-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]pyrazol-3-yl]phenyl]-N-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxymethanimine |
|---|---|
| PubChem CID | 172933748 |
| Molecular Formula | C27H28F5N3O6 |
| Molecular Weight | 585.53 g/mol |
| Exact Mass | 585.19 |
| IUPAC Name | (E)-1-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]pyrazol-3-yl]phenyl]-N-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxymethanimine |
| SMILES | CO[C@@H]1[C@@H](OC)[C@H](C)O[C@@H](O/N=C/c2ccc(-c3ccn(-c4ccc(OC(F)(F)C(F)(F)F)cc4)n3)cc2)[C@@H]1OC |
| InChI | InChI=1S/C27H28F5N3O6/c1-16-22(36-2)23(37-3)24(38-4)25(39-16)41-33-15-17-5-7-18(8-6-17)21-13-14-35(34-21)19-9-11-20(12-10-19)40-27(31,32)26(28,29)30/h5-16,22-25H,1-4H3/b33-15+/t16-,22-,23+,24+,25-/m0/s1 |
| InChIKey | JQLDTCOYZNBKLI-YOVCZXGQSA-N |
| XLogP | 5.21 |
| TPSA | 85.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.53 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|