C26H30F3N3O7 — CID 122576591
(E)-N-[(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl]oxy-1-[4-[3-[4-(trifluoromethoxy)phenyl]-2,5-dihydro-1,2,4-oxadiazol-5-yl]phenyl]methanimine (PubChem CID 122576591) has the molecular formula C26H30F3N3O7 and a molecular weight of 553.53 g/mol. Its IUPAC name is (E)-N-[(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl]oxy-1-[4-[3-[4-(trifluoromethoxy)phenyl]-2,5-dihydro-1,2,4-oxadiazol-5-yl]phenyl]methanimine.
| Compound Name | (E)-N-[(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl]oxy-1-[4-[3-[4-(trifluoromethoxy)phenyl]-2,5-dihydro-1,2,4-oxadiazol-5-yl]phenyl]methanimine |
|---|---|
| PubChem CID | 122576591 |
| Molecular Formula | C26H30F3N3O7 |
| Molecular Weight | 553.53 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | (E)-N-[(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl]oxy-1-[4-[3-[4-(trifluoromethoxy)phenyl]-2,5-dihydro-1,2,4-oxadiazol-5-yl]phenyl]methanimine |
| SMILES | CCO[C@@H]1[C@@H](OC)[C@H](C)O[C@@H](O/N=C/c2ccc(C3N=C(c4ccc(OC(F)(F)F)cc4)NO3)cc2)[C@@H]1OC |
| InChI | InChI=1S/C26H30F3N3O7/c1-5-35-21-20(33-3)15(2)36-25(22(21)34-4)39-30-14-16-6-8-18(9-7-16)24-31-23(32-38-24)17-10-12-19(13-11-17)37-26(27,28)29/h6-15,20-22,24-25H,5H2,1-4H3,(H,31,32)/b30-14+/t15-,20-,21+,22+,24?,25-/m0/s1 |
| InChIKey | BJTBHEGIYIFJNR-JOXLMEIRSA-N |
| XLogP | 4.10 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|