C26H33NO5 — CID 59441495
(E)-N-[(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl]oxy-1-[4-[(E)-2-(3-methylphenyl)ethenyl]phenyl]methanimine (PubChem CID 59441495) has the molecular formula C26H33NO5 and a molecular weight of 439.55 g/mol. Its IUPAC name is (E)-N-[(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl]oxy-1-[4-[(E)-2-(3-methylphenyl)ethenyl]phenyl]methanimine.
| Compound Name | (E)-N-[(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl]oxy-1-[4-[(E)-2-(3-methylphenyl)ethenyl]phenyl]methanimine |
|---|---|
| PubChem CID | 59441495 |
| Molecular Formula | C26H33NO5 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | (E)-N-[(2S,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl]oxy-1-[4-[(E)-2-(3-methylphenyl)ethenyl]phenyl]methanimine |
| SMILES | CCO[C@@H]1[C@@H](OC)[C@H](C)O[C@@H](O/N=C/c2ccc(/C=C/c3cccc(C)c3)cc2)[C@@H]1OC |
| InChI | InChI=1S/C26H33NO5/c1-6-30-24-23(28-4)19(3)31-26(25(24)29-5)32-27-17-22-14-11-20(12-15-22)10-13-21-9-7-8-18(2)16-21/h7-17,19,23-26H,6H2,1-5H3/b13-10+,27-17+/t19-,23-,24+,25+,26-/m0/s1 |
| InChIKey | FRYJXGWAFKWIFW-XKAQNECTSA-N |
| XLogP | 4.70 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|