C27H28F3N3O6 — CID 122576443
(E)-1-[4-[2-[4-(trifluoromethoxy)phenyl]pyrimidin-4-yl]phenyl]-N-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxymethanimine (PubChem CID 122576443) has the molecular formula C27H28F3N3O6 and a molecular weight of 547.53 g/mol. Its IUPAC name is (E)-1-[4-[2-[4-(trifluoromethoxy)phenyl]pyrimidin-4-yl]phenyl]-N-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxymethanimine.
| Compound Name | (E)-1-[4-[2-[4-(trifluoromethoxy)phenyl]pyrimidin-4-yl]phenyl]-N-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxymethanimine |
|---|---|
| PubChem CID | 122576443 |
| Molecular Formula | C27H28F3N3O6 |
| Molecular Weight | 547.53 g/mol |
| Exact Mass | 547.19 |
| IUPAC Name | (E)-1-[4-[2-[4-(trifluoromethoxy)phenyl]pyrimidin-4-yl]phenyl]-N-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxymethanimine |
| SMILES | CO[C@@H]1[C@@H](OC)[C@H](C)O[C@@H](O/N=C/c2ccc(-c3ccnc(-c4ccc(OC(F)(F)F)cc4)n3)cc2)[C@@H]1OC |
| InChI | InChI=1S/C27H28F3N3O6/c1-16-22(34-2)23(35-3)24(36-4)26(37-16)39-32-15-17-5-7-18(8-6-17)21-13-14-31-25(33-21)19-9-11-20(12-10-19)38-27(28,29)30/h5-16,22-24,26H,1-4H3/b32-15+/t16-,22-,23+,24+,26-/m0/s1 |
| InChIKey | IFCFIBPQXVCXMM-OXVJUYEQSA-N |
| XLogP | 4.85 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|